C30H39N3O5S2 — CID 166874184
(E)-1-cyano-2-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[(2R,3S,4R)-2,3,4-trihydroxyhexyl]prop-1-ene-1-sulfonamide (PubChem CID 166874184) has the molecular formula C30H39N3O5S2 and a molecular weight of 585.79 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[(2R,3S,4R)-2,3,4-trihydroxyhexyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[(2R,3S,4R)-2,3,4-trihydroxyhexyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 166874184 |
| Molecular Formula | C30H39N3O5S2 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[(2R,3S,4R)-2,3,4-trihydroxyhexyl]prop-1-ene-1-sulfonamide |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(/C(C)=C(\C#N)S(=O)(=O)NC[C@@H](O)[C@@H](O)[C@H](O)CC)s3)ccc2c1 |
| InChI | InChI=1S/C30H39N3O5S2/c1-5-14-33(15-6-2)24-11-10-21-16-23(9-8-22(21)17-24)28-13-12-27(39-28)20(4)29(18-31)40(37,38)32-19-26(35)30(36)25(34)7-3/h8-13,16-17,25-26,30,32,34-36H,5-7,14-15,19H2,1-4H3/b29-20+/t25-,26-,30+/m1/s1 |
| InChIKey | ULMRNRPAMMHSEJ-BHPYGMMCSA-N |
| XLogP | 4.86 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|