About 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene
4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene (PubChem CID 166874319) has the molecular formula C18H34OS
and a molecular weight of 298.54 g/mol. Its IUPAC name is 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene.
Molecular Properties
| Compound Name | 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene |
| PubChem CID | 166874319 |
| Molecular Formula | C18H34OS |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene |
| SMILES | CC=CC(C=CC)(SC)C(CC)(CC)OC(CC)CC |
| InChI | InChI=1S/C18H34OS/c1-8-14-18(20-7,15-9-2)17(12-5,13-6)19-16(10-3)11-4/h8-9,14-16H,10-13H2,1-7H3 |
| InChIKey | RFZSLVJHYCRBIN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene?
The IUPAC name of 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene (CID 166874319) is 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene.
What is the SMILES notation for 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene?
The canonical SMILES for 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene is CC=CC(C=CC)(SC)C(CC)(CC)OC(CC)CC.
What is the InChIKey of 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene?
The InChIKey is RFZSLVJHYCRBIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34OS/c1-8-14-18(20-7,15-9-2)17(12-5,13-6)19-16(10-3)11-4/h8-9,14-16H,10-13H2,1-7H3.
What are the key properties of 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene?
4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene has a molecular weight of 298.54 g/mol, XLogP of 6.00, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-4-(3-pentan-3-yloxypentan-3-yl)hepta-2,5-diene is sourced from PubChem (CID 166874319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).