C37H37NO8 — CID 166874509
methyl 2-[7,9,11,15-tetramethyl-12,16-dioxo-6-[2-[4-(prop-2-ynylcarbamoyl)phenyl]furan-3-yl]-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate (PubChem CID 166874509) has the molecular formula C37H37NO8 and a molecular weight of 623.70 g/mol. Its IUPAC name is methyl 2-[7,9,11,15-tetramethyl-12,16-dioxo-6-[2-[4-(prop-2-ynylcarbamoyl)phenyl]furan-3-yl]-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate.
| Compound Name | methyl 2-[7,9,11,15-tetramethyl-12,16-dioxo-6-[2-[4-(prop-2-ynylcarbamoyl)phenyl]furan-3-yl]-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
|---|---|
| PubChem CID | 166874509 |
| Molecular Formula | C37H37NO8 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | methyl 2-[7,9,11,15-tetramethyl-12,16-dioxo-6-[2-[4-(prop-2-ynylcarbamoyl)phenyl]furan-3-yl]-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
| SMILES | C#CCNC(=O)c1ccc(-c2occc2C2CC3OC4C5OC(=O)C6(C)C=CC(=O)C(C)(C56)C(CC(=O)OC)C4(C)C3=C2C)cc1 |
| InChI | InChI=1S/C37H37NO8/c1-7-15-38-33(41)21-10-8-20(9-11-21)29-22(13-16-44-29)23-17-24-28(19(23)2)37(5)25(18-27(40)43-6)36(4)26(39)12-14-35(3)31(36)30(32(37)45-24)46-34(35)42/h1,8-14,16,23-25,30-32H,15,17-18H2,2-6H3,(H,38,41) |
| InChIKey | OSXGWBPHBMQWKT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|