C30H38O7 — CID 166874512
methyl 3-[(1R,2S,9R,10S,11R,15R,18R)-6-(2-ethylfuran-3-yl)-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]propanoate (PubChem CID 166874512) has the molecular formula C30H38O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is methyl 3-[(1R,2S,9R,10S,11R,15R,18R)-6-(2-ethylfuran-3-yl)-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]propanoate.
| Compound Name | methyl 3-[(1R,2S,9R,10S,11R,15R,18R)-6-(2-ethylfuran-3-yl)-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]propanoate |
|---|---|
| PubChem CID | 166874512 |
| Molecular Formula | C30H38O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | methyl 3-[(1R,2S,9R,10S,11R,15R,18R)-6-(2-ethylfuran-3-yl)-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]propanoate |
| SMILES | CCc1occc1C1CC2O[C@@H]3[C@@H]4OC(=O)[C@]5(C)CCC(=O)[C@](C)([C@@H](CCC(=O)OC)[C@]3(C)C2=C1C)[C@@H]45 |
| InChI | InChI=1S/C30H38O7/c1-7-18-16(11-13-35-18)17-14-19-23(15(17)2)30(5)20(8-9-22(32)34-6)29(4)21(31)10-12-28(3)25(29)24(26(30)36-19)37-27(28)33/h11,13,17,19-20,24-26H,7-10,12,14H2,1-6H3/t17?,19?,20-,24-,25+,26-,28-,29+,30-/m1/s1 |
| InChIKey | ZZFLNLKKFSYIPF-NFBCCLNPSA-N |
| XLogP | 4.92 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|