C24H21N7O — CID 166874829
N-[(2-ethynylphenyl)methyl]-3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide (PubChem CID 166874829) has the molecular formula C24H21N7O and a molecular weight of 423.48 g/mol. Its IUPAC name is N-[(2-ethynylphenyl)methyl]-3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide.
| Compound Name | N-[(2-ethynylphenyl)methyl]-3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 166874829 |
| Molecular Formula | C24H21N7O |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[(2-ethynylphenyl)methyl]-3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide |
| SMILES | C#Cc1ccccc1CNC(=O)c1cccc(NCc2nnc(-c3ccncn3)n2C)c1 |
| InChI | InChI=1S/C24H21N7O/c1-3-17-7-4-5-8-19(17)14-27-24(32)18-9-6-10-20(13-18)26-15-22-29-30-23(31(22)2)21-11-12-25-16-28-21/h1,4-13,16,26H,14-15H2,2H3,(H,27,32) |
| InChIKey | AHCQVTHEWOPAJJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|