About 2,2'-spirobi[1,3,2-benzodithiastannole]
2,2'-spirobi[1,3,2-benzodithiastannole] (PubChem CID 16687541) has the molecular formula C12H8S4Sn
and a molecular weight of 399.18 g/mol. Its IUPAC name is 2,2'-spirobi[1,3,2-benzodithiastannole].
Molecular Properties
| Compound Name | 2,2'-spirobi[1,3,2-benzodithiastannole] |
| PubChem CID | 16687541 |
| Molecular Formula | C12H8S4Sn |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.85 |
| IUPAC Name | 2,2'-spirobi[1,3,2-benzodithiastannole] |
| SMILES | c1ccc2c(c1)S[Sn]1(S2)Sc2ccccc2S1 |
| InChI | InChI=1S/2C6H6S2.Sn/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,7-8H;/q;;+4/p-4 |
| InChIKey | RWNWDXJUYVFOOM-UHFFFAOYSA-J |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2'-spirobi[1,3,2-benzodithiastannole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-spirobi[1,3,2-benzodithiastannole]?
The IUPAC name of 2,2'-spirobi[1,3,2-benzodithiastannole] (CID 16687541) is 2,2'-spirobi[1,3,2-benzodithiastannole].
What is the SMILES notation for 2,2'-spirobi[1,3,2-benzodithiastannole]?
The canonical SMILES for 2,2'-spirobi[1,3,2-benzodithiastannole] is c1ccc2c(c1)S[Sn]1(S2)Sc2ccccc2S1.
What is the InChIKey of 2,2'-spirobi[1,3,2-benzodithiastannole]?
The InChIKey is RWNWDXJUYVFOOM-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H6S2.Sn/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,7-8H;/q;;+4/p-4.
What are the key properties of 2,2'-spirobi[1,3,2-benzodithiastannole]?
2,2'-spirobi[1,3,2-benzodithiastannole] has a molecular weight of 399.18 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-spirobi[1,3,2-benzodithiastannole] is sourced from PubChem (CID 16687541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).