C38H42Cl2N8O5 — CID 166876190
(E)-N-[3-[1-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylanilino)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]ethyl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 166876190) has the molecular formula C38H42Cl2N8O5 and a molecular weight of 761.71 g/mol. Its IUPAC name is (E)-N-[3-[1-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylanilino)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]ethyl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-[1-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylanilino)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]ethyl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 166876190 |
| Molecular Formula | C38H42Cl2N8O5 |
| Molecular Weight | 761.71 g/mol |
| Exact Mass | 760.27 |
| IUPAC Name | (E)-N-[3-[1-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylanilino)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]ethyl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | COc1cc(OC)c(Cl)c(N2Cc3cnc(Nc4ccc(N5CCOCC5)cc4)nc3N(C(C)c3cccc(NC(=O)/C=C/CN(C)C)c3)C2=O)c1Cl |
| InChI | InChI=1S/C38H42Cl2N8O5/c1-24(25-8-6-9-28(20-25)42-32(49)10-7-15-45(2)3)48-36-26(23-47(38(48)50)35-33(39)30(51-4)21-31(52-5)34(35)40)22-41-37(44-36)43-27-11-13-29(14-12-27)46-16-18-53-19-17-46/h6-14,20-22,24H,15-19,23H2,1-5H3,(H,42,49)(H,41,43,44)/b10-7+ |
| InChIKey | MVSHIQMJLNMANX-JXMROGBWSA-N |
| XLogP | 7.14 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|