About 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine
5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine (PubChem CID 166876717) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine |
| PubChem CID | 166876717 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine |
| SMILES | [H]/N=C/C(CCCN)=C(C=C)C=C |
| InChI | InChI=1S/C10H16N2/c1-3-9(4-2)10(8-12)6-5-7-11/h3-4,8,12H,1-2,5-7,11H2/b12-8+ |
| InChIKey | CWSNFMKSSGTLRJ-XYOKQWHBSA-N |
| XLogP | 2.04 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine?
The IUPAC name of 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine (CID 166876717) is 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine.
What is the SMILES notation for 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine?
The canonical SMILES for 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine is [H]/N=C/C(CCCN)=C(C=C)C=C.
What is the InChIKey of 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine?
The InChIKey is CWSNFMKSSGTLRJ-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-9(4-2)10(8-12)6-5-7-11/h3-4,8,12H,1-2,5-7,11H2/b12-8+.
What are the key properties of 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine?
5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine has a molecular weight of 164.25 g/mol, XLogP of 2.04, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-methanimidoylhepta-4,6-dien-1-amine is sourced from PubChem (CID 166876717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).