C22H32N2O — CID 166876744
(2Z,4Z,7Z,9Z)-3-ethenyl-4-(methylaminomethylidene)-7-[(4Z)-5-(methylamino)-3-methylidenepenta-1,4-dien-2-yl]undeca-2,7,9-trien-1-ol (PubChem CID 166876744) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is (2Z,4Z,7Z,9Z)-3-ethenyl-4-(methylaminomethylidene)-7-[(4Z)-5-(methylamino)-3-methylidenepenta-1,4-dien-2-yl]undeca-2,7,9-trien-1-ol.
| Compound Name | (2Z,4Z,7Z,9Z)-3-ethenyl-4-(methylaminomethylidene)-7-[(4Z)-5-(methylamino)-3-methylidenepenta-1,4-dien-2-yl]undeca-2,7,9-trien-1-ol |
|---|---|
| PubChem CID | 166876744 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (2Z,4Z,7Z,9Z)-3-ethenyl-4-(methylaminomethylidene)-7-[(4Z)-5-(methylamino)-3-methylidenepenta-1,4-dien-2-yl]undeca-2,7,9-trien-1-ol |
| SMILES | C=CC(=C/CO)/C(=C\NC)CC/C(=C/C=C\C)C(=C)C(=C)/C=C\NC |
| InChI | InChI=1S/C22H32N2O/c1-7-9-10-21(19(4)18(3)13-15-23-5)11-12-22(17-24-6)20(8-2)14-16-25/h7-10,13-15,17,23-25H,2-4,11-12,16H2,1,5-6H3/b9-7-,15-13-,20-14-,21-10-,22-17- |
| InChIKey | LKAPEZRFMLQERR-VEGQYCGBSA-N |
| XLogP | 4.32 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|