C25H40F2N4 — CID 166876816
(1Z,5Z,7Z)-7-N-(2,2-difluoroethyl)-6-N,6-N-dimethyl-2-[(3Z)-2-methylhepta-1,3-dien-3-yl]-9-methylimino-5-prop-2-enylidenenona-1,7-diene-1,6,7-triamine (PubChem CID 166876816) has the molecular formula C25H40F2N4 and a molecular weight of 434.62 g/mol. Its IUPAC name is (1Z,5Z,7Z)-7-N-(2,2-difluoroethyl)-6-N,6-N-dimethyl-2-[(3Z)-2-methylhepta-1,3-dien-3-yl]-9-methylimino-5-prop-2-enylidenenona-1,7-diene-1,6,7-triamine.
| Compound Name | (1Z,5Z,7Z)-7-N-(2,2-difluoroethyl)-6-N,6-N-dimethyl-2-[(3Z)-2-methylhepta-1,3-dien-3-yl]-9-methylimino-5-prop-2-enylidenenona-1,7-diene-1,6,7-triamine |
|---|---|
| PubChem CID | 166876816 |
| Molecular Formula | C25H40F2N4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (1Z,5Z,7Z)-7-N-(2,2-difluoroethyl)-6-N,6-N-dimethyl-2-[(3Z)-2-methylhepta-1,3-dien-3-yl]-9-methylimino-5-prop-2-enylidenenona-1,7-diene-1,6,7-triamine |
| SMILES | C=C/C=C(/CCC(=C/N)/C(=C\CCC)C(=C)C)C(/C(=C/C=N/C)NCC(F)F)N(C)C |
| InChI | InChI=1S/C25H40F2N4/c1-8-10-12-22(19(3)4)21(17-28)14-13-20(11-9-2)25(31(6)7)23(15-16-29-5)30-18-24(26)27/h9,11-12,15-17,24-25,30H,2-3,8,10,13-14,18,28H2,1,4-7H3/b20-11-,21-17-,22-12-,23-15-,29-16+ |
| InChIKey | IVZMQVNWKCXHIY-QOOCGICPSA-N |
| XLogP | 5.39 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|