C25H32FN — CID 166877001
(3E,5E)-N-[3-[2-fluoro-4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-1-en-2-yl]-6,7,7-trimethylocta-1,3,5-trien-3-amine (PubChem CID 166877001) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is (3E,5E)-N-[3-[2-fluoro-4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-1-en-2-yl]-6,7,7-trimethylocta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-[3-[2-fluoro-4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-1-en-2-yl]-6,7,7-trimethylocta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 166877001 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (3E,5E)-N-[3-[2-fluoro-4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-1-en-2-yl]-6,7,7-trimethylocta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C(/C)C(C)(C)C)NC(=C)Cc1ccc(/C(C=C)=C/C)cc1F |
| InChI | InChI=1S/C25H32FN/c1-9-20(10-2)21-13-14-22(24(26)17-21)16-19(5)27-23(11-3)15-12-18(4)25(6,7)8/h9-15,17,27H,1,3,5,16H2,2,4,6-8H3/b18-12+,20-10+,23-15+ |
| InChIKey | XGKJZQFDOSSDLD-HDPGBESRSA-N |
| XLogP | 7.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|