C23H29N4P — CID 166877681
(1Z)-1-(1-aminoethylidene)-N-(3-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine (PubChem CID 166877681) has the molecular formula C23H29N4P and a molecular weight of 392.49 g/mol. Its IUPAC name is (1Z)-1-(1-aminoethylidene)-N-(3-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine.
| Compound Name | (1Z)-1-(1-aminoethylidene)-N-(3-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 166877681 |
| Molecular Formula | C23H29N4P |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (1Z)-1-(1-aminoethylidene)-N-(3-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine |
| SMILES | C/C(N)=C1/NCCC(Nc2cccc(P)c2)c2cc(C3=CCNCC3)ccc21 |
| InChI | InChI=1S/C23H29N4P/c1-15(24)23-20-6-5-17(16-7-10-25-11-8-16)13-21(20)22(9-12-26-23)27-18-3-2-4-19(28)14-18/h2-7,13-14,22,25-27H,8-12,24,28H2,1H3/b23-15- |
| InChIKey | ILAURYDPXNSLER-HAHDFKILSA-N |
| XLogP | 3.36 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|