C25H28ClN5O — CID 166877987
N-[(3E,5E)-6-chlorohepta-1,3,5-trien-4-yl]-N-[1-methyl-9-(1,2,3,6-tetrahydropyridin-4-yl)-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-yl]formamide (PubChem CID 166877987) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is N-[(3E,5E)-6-chlorohepta-1,3,5-trien-4-yl]-N-[1-methyl-9-(1,2,3,6-tetrahydropyridin-4-yl)-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-yl]formamide.
| Compound Name | N-[(3E,5E)-6-chlorohepta-1,3,5-trien-4-yl]-N-[1-methyl-9-(1,2,3,6-tetrahydropyridin-4-yl)-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-yl]formamide |
|---|---|
| PubChem CID | 166877987 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[(3E,5E)-6-chlorohepta-1,3,5-trien-4-yl]-N-[1-methyl-9-(1,2,3,6-tetrahydropyridin-4-yl)-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-yl]formamide |
| SMILES | C=C/C=C(\C=C(/C)Cl)N(C=O)C1CCn2nnc(C)c2-c2ccc(C3=CCNCC3)cc21 |
| InChI | InChI=1S/C25H28ClN5O/c1-4-5-21(14-17(2)26)30(16-32)24-10-13-31-25(18(3)28-29-31)22-7-6-20(15-23(22)24)19-8-11-27-12-9-19/h4-8,14-16,24,27H,1,9-13H2,2-3H3/b17-14+,21-5+ |
| InChIKey | CHBGTQWDWUDBCO-RWYKNCLLSA-N |
| XLogP | 4.75 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|