C25H32N4O2 — CID 166878212
2-[4-[[(1Z)-1-(1-aminoethylidene)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]phenoxy]ethanol (PubChem CID 166878212) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[4-[[(1Z)-1-(1-aminoethylidene)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]phenoxy]ethanol.
| Compound Name | 2-[4-[[(1Z)-1-(1-aminoethylidene)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]phenoxy]ethanol |
|---|---|
| PubChem CID | 166878212 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[4-[[(1Z)-1-(1-aminoethylidene)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]phenoxy]ethanol |
| SMILES | C/C(N)=C1/NCCC(Nc2ccc(OCCO)cc2)c2cc(C3=CCNCC3)ccc21 |
| InChI | InChI=1S/C25H32N4O2/c1-17(26)25-22-7-2-19(18-8-11-27-12-9-18)16-23(22)24(10-13-28-25)29-20-3-5-21(6-4-20)31-15-14-30/h2-8,16,24,27-30H,9-15,26H2,1H3/b25-17- |
| InChIKey | BFTHAOHSZMRMLW-UQQQWYQISA-N |
| XLogP | 3.23 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|