C25H30N6 — CID 166878346
(1Z)-1-(1-aminoethylidene)-5-N-(1H-indol-4-yl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-4,5-dihydro-3H-2-benzazepine-2,5-diamine (PubChem CID 166878346) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is (1Z)-1-(1-aminoethylidene)-5-N-(1H-indol-4-yl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-4,5-dihydro-3H-2-benzazepine-2,5-diamine.
| Compound Name | (1Z)-1-(1-aminoethylidene)-5-N-(1H-indol-4-yl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-4,5-dihydro-3H-2-benzazepine-2,5-diamine |
|---|---|
| PubChem CID | 166878346 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (1Z)-1-(1-aminoethylidene)-5-N-(1H-indol-4-yl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-4,5-dihydro-3H-2-benzazepine-2,5-diamine |
| SMILES | C/C(N)=C1\c2ccc(C3=CCNCC3)cc2C(Nc2cccc3[nH]ccc23)CCN1N |
| InChI | InChI=1S/C25H30N6/c1-16(26)25-19-6-5-18(17-7-11-28-12-8-17)15-21(19)24(10-14-31(25)27)30-23-4-2-3-22-20(23)9-13-29-22/h2-7,9,13,15,24,28-30H,8,10-12,14,26-27H2,1H3/b25-16- |
| InChIKey | JFRUZPQSIANFPA-XYGWBWBKSA-N |
| XLogP | 3.92 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|