C20H16ClF8N5O2 — CID 166878572
5-chloro-N-[1-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]-3-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 166878572) has the molecular formula C20H16ClF8N5O2 and a molecular weight of 545.82 g/mol. Its IUPAC name is 5-chloro-N-[1-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]-3-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 5-chloro-N-[1-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]-3-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 166878572 |
| Molecular Formula | C20H16ClF8N5O2 |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 5-chloro-N-[1-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]-3-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(NC(=O)C1=CC(C(F)(F)F)CC(Cl)=C1)c1ncnn1-c1ccc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H16ClF8N5O2/c1-10(33-17(35)11-4-12(19(24,25)26)6-13(21)5-11)16-31-9-32-34(16)15-3-2-14(7-30-15)36-8-18(22,23)20(27,28)29/h2-5,7,9-10,12H,6,8H2,1H3,(H,33,35) |
| InChIKey | WVMGOAPTAUCOHU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|