About 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine
5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine (PubChem CID 166878634) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine |
| PubChem CID | 166878634 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine |
| SMILES | Cc1ccc(-n2ncnc2C(C)C)nc1 |
| InChI | InChI=1S/C11H14N4/c1-8(2)11-13-7-14-15(11)10-5-4-9(3)6-12-10/h4-8H,1-3H3 |
| InChIKey | MXHUUACUTOFFTE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine?
The IUPAC name of 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine (CID 166878634) is 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine.
What is the SMILES notation for 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine?
The canonical SMILES for 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine is Cc1ccc(-n2ncnc2C(C)C)nc1.
What is the InChIKey of 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine?
The InChIKey is MXHUUACUTOFFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-8(2)11-13-7-14-15(11)10-5-4-9(3)6-12-10/h4-8H,1-3H3.
What are the key properties of 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine?
5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine has a molecular weight of 202.26 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(5-propan-2-yl-1,2,4-triazol-1-yl)pyridine is sourced from PubChem (CID 166878634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).