C25H23NS — CID 166879246
4-dibenzothiophen-2-yl-N-[(2E,4Z)-hepta-2,4-dien-3-yl]aniline (PubChem CID 166879246) has the molecular formula C25H23NS and a molecular weight of 369.53 g/mol. Its IUPAC name is 4-dibenzothiophen-2-yl-N-[(2E,4Z)-hepta-2,4-dien-3-yl]aniline.
| Compound Name | 4-dibenzothiophen-2-yl-N-[(2E,4Z)-hepta-2,4-dien-3-yl]aniline |
|---|---|
| PubChem CID | 166879246 |
| Molecular Formula | C25H23NS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-dibenzothiophen-2-yl-N-[(2E,4Z)-hepta-2,4-dien-3-yl]aniline |
| SMILES | C/C=C(\C=C/CC)Nc1ccc(-c2ccc3sc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C25H23NS/c1-3-5-8-20(4-2)26-21-14-11-18(12-15-21)19-13-16-25-23(17-19)22-9-6-7-10-24(22)27-25/h4-17,26H,3H2,1-2H3/b8-5-,20-4+ |
| InChIKey | HOJSWIGAXYFQKC-BGSINUBSSA-N |
| XLogP | 8.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|