About N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene
N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene (PubChem CID 16687956) has the molecular formula C10H20GeN2
and a molecular weight of 240.89 g/mol.
Molecular Properties
| Compound Name | N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene |
| PubChem CID | 16687956 |
| Molecular Formula | C10H20GeN2 |
| Molecular Weight | 240.89 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Ge]1 |
| InChI | InChI=1S/C10H20GeN2/c1-9(2,3)12-7-8-13(11-12)10(4,5)6/h7-8H,1-6H3 |
| InChIKey | GZSSYPXUFFGMBM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene?
The IUPAC name of N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene (CID 16687956) is not available.
What is the SMILES notation for N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene?
The canonical SMILES for N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene is CC(C)(C)N1C=CN(C(C)(C)C)[Ge]1.
What is the InChIKey of N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene?
The InChIKey is GZSSYPXUFFGMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20GeN2/c1-9(2,3)12-7-8-13(11-12)10(4,5)6/h7-8H,1-6H3.
What are the key properties of N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene?
N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene has a molecular weight of 240.89 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di-t-butyl-1-germa-2,5-diaza-3-cyclopentene is sourced from PubChem (CID 16687956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).