C21H22FN3O2 — CID 166879985
2-[3-fluoro-4-[4-(methylamino)butyl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 166879985) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(methylamino)butyl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[3-fluoro-4-[4-(methylamino)butyl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 166879985 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[3-fluoro-4-[4-(methylamino)butyl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | CNCCCCc1ccc(-c2[nH]c3cccc4c3c2CONC4=O)cc1F |
| InChI | InChI=1S/C21H22FN3O2/c1-23-10-3-2-5-13-8-9-14(11-17(13)22)20-16-12-27-25-21(26)15-6-4-7-18(24-20)19(15)16/h4,6-9,11,23-24H,2-3,5,10,12H2,1H3,(H,25,26) |
| InChIKey | IJQIGOLMYOBDAE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|