C20H20FN3O2 — CID 166880012
2-[4-(4-aminobutyl)phenyl]-6-fluoro-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 166880012) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[4-(4-aminobutyl)phenyl]-6-fluoro-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(4-aminobutyl)phenyl]-6-fluoro-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 166880012 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[4-(4-aminobutyl)phenyl]-6-fluoro-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | NCCCCc1ccc(-c2[nH]c3cc(F)cc4c3c2CONC4=O)cc1 |
| InChI | InChI=1S/C20H20FN3O2/c21-14-9-15-18-16(11-26-24-20(15)25)19(23-17(18)10-14)13-6-4-12(5-7-13)3-1-2-8-22/h4-7,9-10,23H,1-3,8,11,22H2,(H,24,25) |
| InChIKey | DNPVENHPTWAMJH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|