C35H53F3O4S — CID 166880200
(2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxy-6-methylheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol (PubChem CID 166880200) has the molecular formula C35H53F3O4S and a molecular weight of 626.87 g/mol. Its IUPAC name is (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxy-6-methylheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxy-6-methylheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 166880200 |
| Molecular Formula | C35H53F3O4S |
| Molecular Weight | 626.87 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxy-6-methylheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol |
| SMILES | CCCC[C@H]1[C@H]([C@@H]2CC[C@H]([C@H](C)CC(CC(C)(O)C(F)(F)F)S(=O)(=O)c3ccccc3)C2)CC=C2C[C@](O)(CC)CC[C@@H]21 |
| InChI | InChI=1S/C35H53F3O4S/c1-5-7-13-32-30(17-16-27-22-34(40,6-2)19-18-31(27)32)26-15-14-25(21-26)24(3)20-29(23-33(4,39)35(36,37)38)43(41,42)28-11-9-8-10-12-28/h8-12,16,24-26,29-32,39-40H,5-7,13-15,17-23H2,1-4H3/t24-,25+,26-,29?,30+,31+,32+,33?,34+/m1/s1 |
| InChIKey | KSIJNPFSLFKLEV-METIVFSUSA-N |
| XLogP | 8.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.87 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|