C32H72O4Si2Sn2 — CID 16688029
2,2,4,4,6,6,8,8-octatert-butyl-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane (PubChem CID 16688029) has the molecular formula C32H72O4Si2Sn2 and a molecular weight of 814.52 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octatert-butyl-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane.
| Compound Name | 2,2,4,4,6,6,8,8-octatert-butyl-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane |
|---|---|
| PubChem CID | 16688029 |
| Molecular Formula | C32H72O4Si2Sn2 |
| Molecular Weight | 814.52 g/mol |
| Exact Mass | 816.30 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octatert-butyl-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[Sn](C(C)(C)C)(C(C)(C)C)O[Si](C(C)(C)C)(C(C)(C)C)O[Sn](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/2C8H18O2Si.4C4H9.2Sn/c2*1-7(2,3)11(9,10)8(4,5)6;4*1-4(2)3;;/h2*1-6H3;4*1-3H3;;/q2*-2;;;;;2*+2 |
| InChIKey | BQNGBYHVWMHAHW-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.52 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|