C24H44N4Pb4 — CID 16688035
1,3,5,7-tetracyclohexyl-1,3,5,7,2λ2,4λ2,6λ2,8λ2-tetrazatetraplumbocane (PubChem CID 16688035) has the molecular formula C24H44N4Pb4 and a molecular weight of 1217.44 g/mol. Its IUPAC name is 1,3,5,7-tetracyclohexyl-1,3,5,7,2λ2,4λ2,6λ2,8λ2-tetrazatetraplumbocane.
| Compound Name | 1,3,5,7-tetracyclohexyl-1,3,5,7,2λ2,4λ2,6λ2,8λ2-tetrazatetraplumbocane |
|---|---|
| PubChem CID | 16688035 |
| Molecular Formula | C24H44N4Pb4 |
| Molecular Weight | 1217.44 g/mol |
| Exact Mass | 1220.26 |
| IUPAC Name | 1,3,5,7-tetracyclohexyl-1,3,5,7,2λ2,4λ2,6λ2,8λ2-tetrazatetraplumbocane |
| SMILES | C1CCC(N2[Pb]N(C3CCCCC3)[Pb]N(C3CCCCC3)[Pb]N(C3CCCCC3)[Pb]2)CC1 |
| InChI | InChI=1S/4C6H11N.4Pb/c4*7-6-4-2-1-3-5-6;;;;/h4*6H,1-5H2;;;; |
| InChIKey | HGPGVQGKPNASFI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1217.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |