C26H32F4N6O2 — CID 166880558
N-ethyl-3-[(Z)-1-[[(E)-2-fluoroethenyl]amino]-2-(prop-2-enylideneamino)ethenyl]-N-[(2-hydroxy-3,4-dimethylcyclopentyl)methyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridine-6-carboxamide (PubChem CID 166880558) has the molecular formula C26H32F4N6O2 and a molecular weight of 536.57 g/mol. Its IUPAC name is N-ethyl-3-[(Z)-1-[[(E)-2-fluoroethenyl]amino]-2-(prop-2-enylideneamino)ethenyl]-N-[(2-hydroxy-3,4-dimethylcyclopentyl)methyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridine-6-carboxamide.
| Compound Name | N-ethyl-3-[(Z)-1-[[(E)-2-fluoroethenyl]amino]-2-(prop-2-enylideneamino)ethenyl]-N-[(2-hydroxy-3,4-dimethylcyclopentyl)methyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 166880558 |
| Molecular Formula | C26H32F4N6O2 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N-ethyl-3-[(Z)-1-[[(E)-2-fluoroethenyl]amino]-2-(prop-2-enylideneamino)ethenyl]-N-[(2-hydroxy-3,4-dimethylcyclopentyl)methyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridine-6-carboxamide |
| SMILES | C=C/C=N/C=C(\N/C=C/F)c1nn(CC(F)(F)F)c2cc(C(=O)N(CC)CC3CC(C)C(C)C3O)ncc12 |
| InChI | InChI=1S/C26H32F4N6O2/c1-5-8-31-13-21(32-9-7-27)23-19-12-33-20(11-22(19)36(34-23)15-26(28,29)30)25(38)35(6-2)14-18-10-16(3)17(4)24(18)37/h5,7-9,11-13,16-18,24,32,37H,1,6,10,14-15H2,2-4H3/b9-7+,21-13-,31-8+ |
| InChIKey | BHJLPQLUPKGNFG-KTBVKBJMSA-N |
| XLogP | 4.69 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|