About 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine
1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine (PubChem CID 166880635) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine.
Molecular Properties
| Compound Name | 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine |
| PubChem CID | 166880635 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H]1CC[C@H](C)N(C)C1 |
| InChI | InChI=1S/C9H20N4/c1-7-4-5-8(6-13(7)3)12-9(10)11-2/h7-8H,4-6H2,1-3H3,(H3,10,11,12)/t7-,8-/m0/s1 |
| InChIKey | VIHVVGMKIVEUGQ-YUMQZZPRSA-N |
| XLogP | 0.00 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine?
The IUPAC name of 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine (CID 166880635) is 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine.
What is the SMILES notation for 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine?
The canonical SMILES for 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine is C/N=C(\N)N[C@H]1CC[C@H](C)N(C)C1.
What is the InChIKey of 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine?
The InChIKey is VIHVVGMKIVEUGQ-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H20N4/c1-7-4-5-8(6-13(7)3)12-9(10)11-2/h7-8H,4-6H2,1-3H3,(H3,10,11,12)/t7-,8-/m0/s1.
What are the key properties of 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine?
1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine has a molecular weight of 184.29 g/mol, XLogP of 0.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,6S)-1,6-dimethylpiperidin-3-yl]-2-methylguanidine is sourced from PubChem (CID 166880635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).