C24H28FN — CID 166881024
3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,9(17),12,14-hexaene (PubChem CID 166881024) has the molecular formula C24H28FN and a molecular weight of 349.49 g/mol. Its IUPAC name is 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,9(17),12,14-hexaene.
| Compound Name | 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,9(17),12,14-hexaene |
|---|---|
| PubChem CID | 166881024 |
| Molecular Formula | C24H28FN |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,9(17),12,14-hexaene |
| SMILES | CC=CCC1CC=C(F)C2=C1c1nccc3c1=C(C(C)(C)CC=3)C2(C)C |
| InChI | InChI=1S/C24H28FN/c1-6-7-8-15-9-10-17(25)20-18(15)21-19-16(12-14-26-21)11-13-23(2,3)22(19)24(20,4)5/h6-7,10-12,14-15H,8-9,13H2,1-5H3 |
| InChIKey | GNBHVGSQSUBHNT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|