C25H32FN — CID 166881050
3-ethyl-6-fluoro-2,4,5,8,8,10,10-heptamethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,6,9(17),12,14-hexaene (PubChem CID 166881050) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-2,4,5,8,8,10,10-heptamethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,6,9(17),12,14-hexaene.
| Compound Name | 3-ethyl-6-fluoro-2,4,5,8,8,10,10-heptamethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,6,9(17),12,14-hexaene |
|---|---|
| PubChem CID | 166881050 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 3-ethyl-6-fluoro-2,4,5,8,8,10,10-heptamethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,6,9(17),12,14-hexaene |
| SMILES | CCC1=C(C)C(C)C(F)=C2C(C)(C)C3=c4c(nccc4=CCC3(C)C)C12C |
| InChI | InChI=1S/C25H32FN/c1-9-17-14(2)15(3)19(26)21-24(6,7)20-18-16(10-12-23(20,4)5)11-13-27-22(18)25(17,21)8/h10-11,13,15H,9,12H2,1-8H3 |
| InChIKey | VVJLDQJSIUXBAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|