C23H26FN — CID 166881052
3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene (PubChem CID 166881052) has the molecular formula C23H26FN and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene.
| Compound Name | 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene |
|---|---|
| PubChem CID | 166881052 |
| Molecular Formula | C23H26FN |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-but-2-enyl-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene |
| SMILES | CC=CCC1CC=C(F)C2=C1c1nccc3c1=C(C(C)(C)C=3)C2(C)C |
| InChI | InChI=1S/C23H26FN/c1-6-7-8-14-9-10-16(24)19-17(14)20-18-15(11-12-25-20)13-22(2,3)21(18)23(19,4)5/h6-7,10-14H,8-9H2,1-5H3 |
| InChIKey | KZXWVTLQYQXKCT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|