C10H14O7 — CID 166881081
trans-(3R,5R)-1,3,5-trihydroxy-4-prop-2-enoyloxycyclohexane-1-carboxylic acid (PubChem CID 166881081) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is trans-(3R,5R)-1,3,5-trihydroxy-4-prop-2-enoyloxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-1,3,5-trihydroxy-4-prop-2-enoyloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166881081 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | trans-(3R,5R)-1,3,5-trihydroxy-4-prop-2-enoyloxycyclohexane-1-carboxylic acid |
| SMILES | C=CC(=O)OC1[C@H](O)CC(O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C10H14O7/c1-2-7(13)17-8-5(11)3-10(16,9(14)15)4-6(8)12/h2,5-6,8,11-12,16H,1,3-4H2,(H,14,15)/t5-,6-,8?,10?/m1/s1 |
| InChIKey | OPXRSQUEUDOGIK-QAPUMBLKSA-N |
| XLogP | -1.58 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|