C9H14FN — CID 166881133
N-[(1E,3E)-2-fluoro-4,5-dimethylhexa-1,3-dienyl]methanimine (PubChem CID 166881133) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(1E,3E)-2-fluoro-4,5-dimethylhexa-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2-fluoro-4,5-dimethylhexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 166881133 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(1E,3E)-2-fluoro-4,5-dimethylhexa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(F)\C=C(/C)C(C)C |
| InChI | InChI=1S/C9H14FN/c1-7(2)8(3)5-9(10)6-11-4/h5-7H,4H2,1-3H3/b8-5+,9-6+ |
| InChIKey | BSVZTUOEIOQSEE-XVYDYJIPSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|