C20H20FN5O4S2 — CID 166881169
2-[cyclopropyl(sulfino)amino]-4-[[[4-(6-ethoxypyrazin-2-yl)-2-fluorobenzoyl]amino]methyl]-1,3-thiazole (PubChem CID 166881169) has the molecular formula C20H20FN5O4S2 and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[cyclopropyl(sulfino)amino]-4-[[[4-(6-ethoxypyrazin-2-yl)-2-fluorobenzoyl]amino]methyl]-1,3-thiazole.
| Compound Name | 2-[cyclopropyl(sulfino)amino]-4-[[[4-(6-ethoxypyrazin-2-yl)-2-fluorobenzoyl]amino]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 166881169 |
| Molecular Formula | C20H20FN5O4S2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-[cyclopropyl(sulfino)amino]-4-[[[4-(6-ethoxypyrazin-2-yl)-2-fluorobenzoyl]amino]methyl]-1,3-thiazole |
| SMILES | CCOc1cncc(-c2ccc(C(=O)NCc3csc(N(C4CC4)S(=O)O)n3)c(F)c2)n1 |
| InChI | InChI=1S/C20H20FN5O4S2/c1-2-30-18-10-22-9-17(25-18)12-3-6-15(16(21)7-12)19(27)23-8-13-11-31-20(24-13)26(32(28)29)14-4-5-14/h3,6-7,9-11,14H,2,4-5,8H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | VGVYYEGQAMNGFX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|