C12H13ClN2O — CID 166881297
4-chloro-5-ethyl-11-oxa-3,8-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 166881297) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-chloro-5-ethyl-11-oxa-3,8-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | 4-chloro-5-ethyl-11-oxa-3,8-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 166881297 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-chloro-5-ethyl-11-oxa-3,8-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | CCc1cc2[nH]c3c(c2nc1Cl)CCOC3 |
| InChI | InChI=1S/C12H13ClN2O/c1-2-7-5-9-11(15-12(7)13)8-3-4-16-6-10(8)14-9/h5,14H,2-4,6H2,1H3 |
| InChIKey | GNWIOCHCJODFON-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|