C13H18N2 — CID 166881378
4-ethyl-5,6,6a,7,8,9-hexahydropyrrolo[1,2-a][1,8]naphthyridine (PubChem CID 166881378) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-ethyl-5,6,6a,7,8,9-hexahydropyrrolo[1,2-a][1,8]naphthyridine.
| Compound Name | 4-ethyl-5,6,6a,7,8,9-hexahydropyrrolo[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 166881378 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-ethyl-5,6,6a,7,8,9-hexahydropyrrolo[1,2-a][1,8]naphthyridine |
| SMILES | CCc1ccnc2c1CCC1CCCN21 |
| InChI | InChI=1S/C13H18N2/c1-2-10-7-8-14-13-12(10)6-5-11-4-3-9-15(11)13/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | OUHNUWIJAABTTG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |