About diphenylmethylbenzene;hexachloroantimony(1-)
diphenylmethylbenzene;hexachloroantimony(1-) (PubChem CID 16688166) has the molecular formula C19H15Cl6Sb
and a molecular weight of 577.81 g/mol. Its IUPAC name is diphenylmethylbenzene;hexachloroantimony(1-).
Molecular Properties
| Compound Name | diphenylmethylbenzene;hexachloroantimony(1-) |
| PubChem CID | 16688166 |
| Molecular Formula | C19H15Cl6Sb |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 573.83 |
| IUPAC Name | diphenylmethylbenzene;hexachloroantimony(1-) |
| SMILES | Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.6ClH.Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;/h1-15H;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | GASWLBDVMZXHOP-UHFFFAOYSA-H |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethylbenzene;hexachloroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethylbenzene;hexachloroantimony(1-)?
The IUPAC name of diphenylmethylbenzene;hexachloroantimony(1-) (CID 16688166) is diphenylmethylbenzene;hexachloroantimony(1-).
What is the SMILES notation for diphenylmethylbenzene;hexachloroantimony(1-)?
The canonical SMILES for diphenylmethylbenzene;hexachloroantimony(1-) is Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.c1ccc([C+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylmethylbenzene;hexachloroantimony(1-)?
The InChIKey is GASWLBDVMZXHOP-UHFFFAOYSA-H. The full InChI is InChI=1S/C19H15.6ClH.Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;/h1-15H;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of diphenylmethylbenzene;hexachloroantimony(1-)?
diphenylmethylbenzene;hexachloroantimony(1-) has a molecular weight of 577.81 g/mol, XLogP of 8.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene;hexachloroantimony(1-) is sourced from PubChem (CID 16688166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).