C27H30F2O2 — CID 166881936
(8S,11R,13S,14S,17R)-11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-17-prop-1-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 166881936) has the molecular formula C27H30F2O2 and a molecular weight of 424.53 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-17-prop-1-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-17-prop-1-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 166881936 |
| Molecular Formula | C27H30F2O2 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (8S,11R,13S,14S,17R)-11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-17-prop-1-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC=C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3cc(F)cc(F)c3)C[C@@]21C |
| InChI | InChI=1S/C27H30F2O2/c1-3-9-27(31)10-8-24-22-6-4-16-13-20(30)5-7-21(16)25(22)23(15-26(24,27)2)17-11-18(28)14-19(29)12-17/h3,9,11-14,22-24,31H,4-8,10,15H2,1-2H3/t22-,23+,24-,26-,27-/m0/s1 |
| InChIKey | QOEQJQUATWMAHW-YEEPMTPTSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|