C32H27N3O2 — CID 166882295
14-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-5,8-dicarbonitrile (PubChem CID 166882295) has the molecular formula C32H27N3O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 14-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-5,8-dicarbonitrile.
| Compound Name | 14-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-5,8-dicarbonitrile |
|---|---|
| PubChem CID | 166882295 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 14-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-5,8-dicarbonitrile |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)CCc2c(C#N)ccc(C#N)c2CC3)cc1 |
| InChI | InChI=1S/C32H27N3O2/c1-36-29-13-9-26(10-14-29)35(27-11-15-30(37-2)16-12-27)28-8-5-22-6-17-31-24(20-33)3-4-25(21-34)32(31)18-7-23(22)19-28/h3-5,8-16,19H,6-7,17-18H2,1-2H3 |
| InChIKey | NQHDDQDROFHRKQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |