C11H16F2N2O — CID 166882396
3-(3,3-difluorocyclobutyl)-5-pentan-2-yl-1,2,4-oxadiazole (PubChem CID 166882396) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-5-pentan-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(3,3-difluorocyclobutyl)-5-pentan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166882396 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-5-pentan-2-yl-1,2,4-oxadiazole |
| SMILES | CCCC(C)c1nc(C2CC(F)(F)C2)no1 |
| InChI | InChI=1S/C11H16F2N2O/c1-3-4-7(2)10-14-9(15-16-10)8-5-11(12,13)6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | WEKICTKMIOXQJG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |