About 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete
3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete (PubChem CID 166882468) has the molecular formula C18H25N
and a molecular weight of 255.41 g/mol. Its IUPAC name is 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete.
Molecular Properties
| Compound Name | 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete |
| PubChem CID | 166882468 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete |
| SMILES | CC1CC=CC=C([C@H](C2=CN=C2)C2CCCCC2)C1 |
| InChI | InChI=1S/C18H25N/c1-14-7-5-6-10-16(11-14)18(17-12-19-13-17)15-8-3-2-4-9-15/h5-6,10,12-15,18H,2-4,7-9,11H2,1H3/t14?,18-/m1/s1 |
| InChIKey | JJTRPTUANMQYIX-XPKAQORNSA-N |
| XLogP | 5.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete?
The IUPAC name of 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete (CID 166882468) is 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete.
What is the SMILES notation for 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete?
The canonical SMILES for 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete is CC1CC=CC=C([C@H](C2=CN=C2)C2CCCCC2)C1.
What is the InChIKey of 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete?
The InChIKey is JJTRPTUANMQYIX-XPKAQORNSA-N. The full InChI is InChI=1S/C18H25N/c1-14-7-5-6-10-16(11-14)18(17-12-19-13-17)15-8-3-2-4-9-15/h5-6,10,12-15,18H,2-4,7-9,11H2,1H3/t14?,18-/m1/s1.
What are the key properties of 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete?
3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete has a molecular weight of 255.41 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(R)-cyclohexyl-(6-methylcyclohepta-1,3-dien-1-yl)methyl]azete is sourced from PubChem (CID 166882468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).