C14H24F3N3 — CID 166882820
N-[(1E,3E)-3-amino-4-methyl-2-(trifluoromethyl)hexa-1,3-dienyl]-N'-butan-2-ylethanimidamide (PubChem CID 166882820) has the molecular formula C14H24F3N3 and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[(1E,3E)-3-amino-4-methyl-2-(trifluoromethyl)hexa-1,3-dienyl]-N'-butan-2-ylethanimidamide.
| Compound Name | N-[(1E,3E)-3-amino-4-methyl-2-(trifluoromethyl)hexa-1,3-dienyl]-N'-butan-2-ylethanimidamide |
|---|---|
| PubChem CID | 166882820 |
| Molecular Formula | C14H24F3N3 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[(1E,3E)-3-amino-4-methyl-2-(trifluoromethyl)hexa-1,3-dienyl]-N'-butan-2-ylethanimidamide |
| SMILES | CC/C(C)=C(N)\C(=C/N/C(C)=N/C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N3/c1-6-9(3)13(18)12(14(15,16)17)8-19-11(5)20-10(4)7-2/h8,10H,6-7,18H2,1-5H3,(H,19,20)/b12-8+,13-9+ |
| InChIKey | CJYMSPPCWVQCTN-QHKWOANTSA-N |
| XLogP | 3.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|