About 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine
1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine (PubChem CID 166883315) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine |
| PubChem CID | 166883315 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine |
| SMILES | CCC1=CCC(C)(N2CCCC2)C=C1 |
| InChI | InChI=1S/C13H21N/c1-3-12-6-8-13(2,9-7-12)14-10-4-5-11-14/h6-8H,3-5,9-11H2,1-2H3 |
| InChIKey | KOQLCRKOIRUOJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine (CID 166883315) is 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine is CCC1=CCC(C)(N2CCCC2)C=C1.
What is the InChIKey of 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
The InChIKey is KOQLCRKOIRUOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-3-12-6-8-13(2,9-7-12)14-10-4-5-11-14/h6-8H,3-5,9-11H2,1-2H3.
What are the key properties of 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine?
1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine has a molecular weight of 191.32 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-1-methylcyclohexa-2,4-dien-1-yl)pyrrolidine is sourced from PubChem (CID 166883315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).