About 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene
2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene (PubChem CID 166883316) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene |
| PubChem CID | 166883316 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CCC1=C(S(C)(=O)=O)C(C)CC=C1 |
| InChI | InChI=1S/C10H16O2S/c1-4-9-7-5-6-8(2)10(9)13(3,11)12/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | VPOUJAIIFPSSBM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene?
The IUPAC name of 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene (CID 166883316) is 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene?
The canonical SMILES for 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene is CCC1=C(S(C)(=O)=O)C(C)CC=C1.
What is the InChIKey of 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene?
The InChIKey is VPOUJAIIFPSSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-4-9-7-5-6-8(2)10(9)13(3,11)12/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene?
2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene has a molecular weight of 200.30 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methyl-1-methylsulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 166883316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).