C26H23ClF2N6O2S — CID 166883765
(4R)-1-[2-(3-carbamimidoyl-5-methylthieno[3,2-c]pyrazol-1-yl)acetyl]-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 166883765) has the molecular formula C26H23ClF2N6O2S and a molecular weight of 557.03 g/mol. Its IUPAC name is (4R)-1-[2-(3-carbamimidoyl-5-methylthieno[3,2-c]pyrazol-1-yl)acetyl]-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (4R)-1-[2-(3-carbamimidoyl-5-methylthieno[3,2-c]pyrazol-1-yl)acetyl]-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166883765 |
| Molecular Formula | C26H23ClF2N6O2S |
| Molecular Weight | 557.03 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | (4R)-1-[2-(3-carbamimidoyl-5-methylthieno[3,2-c]pyrazol-1-yl)acetyl]-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1nn(CC(=O)N2C[C@H](F)CC2C(=O)Nc2cccc(-c3ccccc3Cl)c2F)c2cc(C)sc12 |
| InChI | InChI=1S/C26H23ClF2N6O2S/c1-13-9-19-24(38-13)23(25(30)31)33-35(19)12-21(36)34-11-14(28)10-20(34)26(37)32-18-8-4-6-16(22(18)29)15-5-2-3-7-17(15)27/h2-9,14,20H,10-12H2,1H3,(H3,30,31)(H,32,37)/t14-,20?/m1/s1 |
| InChIKey | APWISKSEBJFEOB-QMRFKDRMSA-N |
| XLogP | 4.73 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|