C11H16F3N3 — CID 166883881
2-propyl-5-(2,2,2-trifluoroethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 166883881) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-propyl-5-(2,2,2-trifluoroethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-propyl-5-(2,2,2-trifluoroethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 166883881 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-propyl-5-(2,2,2-trifluoroethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CCCc1nc2c([nH]1)CN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C11H16F3N3/c1-2-3-10-15-8-4-5-17(6-9(8)16-10)7-11(12,13)14/h2-7H2,1H3,(H,15,16) |
| InChIKey | VYHUHOVGNDXKGS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |