C17H16ClFN6O — CID 166883920
2-chloro-1-N-[5-(2-fluoro-5-methoxyphenyl)-2-methyl-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine (PubChem CID 166883920) has the molecular formula C17H16ClFN6O and a molecular weight of 374.81 g/mol. Its IUPAC name is 2-chloro-1-N-[5-(2-fluoro-5-methoxyphenyl)-2-methyl-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-[5-(2-fluoro-5-methoxyphenyl)-2-methyl-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 166883920 |
| Molecular Formula | C17H16ClFN6O |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-chloro-1-N-[5-(2-fluoro-5-methoxyphenyl)-2-methyl-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3cc(OC)ccc3F)nn2C)c1Cl |
| InChI | InChI=1S/C17H16ClFN6O/c1-25-17(22-14-6-5-13(21)11(8-20)15(14)18)23-16(24-25)10-7-9(26-2)3-4-12(10)19/h3-8,20H,21H2,1-2H3,(H,22,23,24)/b20-8+ |
| InChIKey | JPZXCTMRLOUSFY-DNTJNYDQSA-N |
| XLogP | 3.61 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|