C21H21ClN4O2 — CID 166884407
[2-[(6-chloro-4-prop-1-ynyl-2,3-dihydro-1H-inden-2-yl)amino]pyrimidin-5-yl]-(1,3-oxazinan-3-yl)methanone (PubChem CID 166884407) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is [2-[(6-chloro-4-prop-1-ynyl-2,3-dihydro-1H-inden-2-yl)amino]pyrimidin-5-yl]-(1,3-oxazinan-3-yl)methanone.
| Compound Name | [2-[(6-chloro-4-prop-1-ynyl-2,3-dihydro-1H-inden-2-yl)amino]pyrimidin-5-yl]-(1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 166884407 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [2-[(6-chloro-4-prop-1-ynyl-2,3-dihydro-1H-inden-2-yl)amino]pyrimidin-5-yl]-(1,3-oxazinan-3-yl)methanone |
| SMILES | CC#Cc1cc(Cl)cc2c1CC(Nc1ncc(C(=O)N3CCCOC3)cn1)C2 |
| InChI | InChI=1S/C21H21ClN4O2/c1-2-4-14-7-17(22)8-15-9-18(10-19(14)15)25-21-23-11-16(12-24-21)20(27)26-5-3-6-28-13-26/h7-8,11-12,18H,3,5-6,9-10,13H2,1H3,(H,23,24,25) |
| InChIKey | IMRKRZSIEHBLPE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|