About 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one
6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 166884810) has the molecular formula C13H15F2N3OS
and a molecular weight of 299.35 g/mol. Its IUPAC name is 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| PubChem CID | 166884810 |
| Molecular Formula | C13H15F2N3OS |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CSc1ncc2c(n1)CN(C1CCC(F)(F)CC1)C2=O |
| InChI | InChI=1S/C13H15F2N3OS/c1-20-12-16-6-9-10(17-12)7-18(11(9)19)8-2-4-13(14,15)5-3-8/h6,8H,2-5,7H2,1H3 |
| InChIKey | NAHZCRMPTDYFEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The IUPAC name of 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (CID 166884810) is 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is CSc1ncc2c(n1)CN(C1CCC(F)(F)CC1)C2=O.
What is the InChIKey of 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The InChIKey is NAHZCRMPTDYFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3OS/c1-20-12-16-6-9-10(17-12)7-18(11(9)19)8-2-4-13(14,15)5-3-8/h6,8H,2-5,7H2,1H3.
What are the key properties of 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one has a molecular weight of 299.35 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-difluorocyclohexyl)-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 166884810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).