About 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole
3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole (PubChem CID 166884990) has the molecular formula C11H16F2N2O2
and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole |
| PubChem CID | 166884990 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole |
| SMILES | CCOC(C)c1cc(CN2CC(F)(F)C2)no1 |
| InChI | InChI=1S/C11H16F2N2O2/c1-3-16-8(2)10-4-9(14-17-10)5-15-6-11(12,13)7-15/h4,8H,3,5-7H2,1-2H3 |
| InChIKey | HCCCLZAUCJLQII-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole?
The IUPAC name of 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole (CID 166884990) is 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole.
What is the SMILES notation for 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole?
The canonical SMILES for 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole is CCOC(C)c1cc(CN2CC(F)(F)C2)no1.
What is the InChIKey of 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole?
The InChIKey is HCCCLZAUCJLQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N2O2/c1-3-16-8(2)10-4-9(14-17-10)5-15-6-11(12,13)7-15/h4,8H,3,5-7H2,1-2H3.
What are the key properties of 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole?
3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole has a molecular weight of 246.26 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-difluoroazetidin-1-yl)methyl]-5-(1-ethoxyethyl)-1,2-oxazole is sourced from PubChem (CID 166884990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).