C28H26F2N6O3 — CID 166885184
6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 166885184) has the molecular formula C28H26F2N6O3 and a molecular weight of 532.55 g/mol. Its IUPAC name is 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166885184 |
| Molecular Formula | C28H26F2N6O3 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 6-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | N[C@@H]1c2ccccc2CC12CCN(c1nc3n[nH]c(C4(c5ccc6c(c5)OC(F)(F)O6)CC4)c3c(=O)[nH]1)CC2 |
| InChI | InChI=1S/C28H26F2N6O3/c29-28(30)38-18-6-5-16(13-19(18)39-28)27(7-8-27)22-20-23(35-34-22)32-25(33-24(20)37)36-11-9-26(10-12-36)14-15-3-1-2-4-17(15)21(26)31/h1-6,13,21H,7-12,14,31H2,(H2,32,33,34,35,37)/t21-/m1/s1 |
| InChIKey | OQKBKUPZOGKQCJ-OAQYLSRUSA-N |
| XLogP | 3.89 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |