About 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine
6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 166885205) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine.
Analyze 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine?
The IUPAC name of 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine (CID 166885205) is 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine.
What is the SMILES notation for 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine?
The canonical SMILES for 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine is CC(C)c1cn2cnnc2nc1C(C)C.
What is the InChIKey of 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine?
The InChIKey is IYZJPHYQNQPXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-7(2)9-5-15-6-12-14-11(15)13-10(9)8(3)4/h5-8H,1-4H3.
What are the key properties of 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine?
6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine has a molecular weight of 204.28 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-di(propan-2-yl)-[1,2,4]triazolo[4,3-a]pyrimidine is sourced from PubChem (CID 166885205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).